Multimetallic complexes of group 10 and 11 metals based on polydentate dithiocarbamate ligands

The ligands KS2CN(Bz)CH2CH2N(Bz)CS2K (K2L1), N(CH2CH2N(Me)CS2Na)(3) (Na3L2), and the new chelates {(CH2CH2)NCS2Na}(3) (Na3L3) and {CH2CH2N(CS2Na)CH2CH2CH2NCS2Na}(2) (Na4L4), react with the gold(I) complexes [ClAu(PR3)] (R = Me, Ph, Cy) and [ClAu(IDip)] to yield di-, tri-and tetragold compounds. Larger metal units can also be coordinated by the longer, flexible linker, K2L1. Thus two equivalents of cis-[PtCl2(PEt3)(2)] react with K2L1 in the presence of NH4PF6 to yield the bimetallic complex [L-1{Pt(PEt3)(2)}(2)](PF6)(2). The compounds [NiCl2(dppp)] and [MCl2(dppf)] (M = Ni, Pd, Pt; dppp = 1,3-bis(diphenylphosphino)propane, dppf = 1,1'-bis(diphenylphosphino)ferrocene) also yield the dications, [L-1{Ni(dppp)}(2)](2+) and [L-1{Ni(dppf)}(2)](2+) in an analogous fashion. In the same manner, reaction between [(L'(2))(AuCl)(2)] (L'(2) = dppm, dppf; dppm = bis(diphenylphosphino)methane) and KS2CN(Bz)CH2CH2N(Bz)CS2K yield [L-1{Au-2(L'(2))}(2)]. The molecular structures of [L-1{M(dppf)}(2)](PF6)(2) (M = Ni, Pd) and [L-1{Au(PR3)}(2)] (R = Me, Ph) are reported.