Mechanochemical synthesis of colloidal sulfur particles in the Na2S2O3-H2(C4H4O4)-Na2SO3 system

Elemental sulfur nanoparticles (nanosulfur, S (n) (0) ) have been obtained in a matrix consisting of sodium sulfite (diluent and a final reaction product) and succinic acid (catalyst) by mechanochemical syntheses via the reaction Na2S2O3 center dot 5H(2)O + H-2(C4H4O4) + zNa(2)SO(3) = (z + 1)Na2SO3 + H-2(C4H4O4) + 5H(2)O+ S (n) (0) , at z = 19.6. It has been shown that free nanodispersed sulfur can be obtained by dissolving the matrix in water. The prepared samples have been characterized using a set of physical and physicochemical methods.